C29H36N2O6 — CID 20570436
5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-8-(5-methylhex-2-ynoxy)-1H-quinolin-2-one (PubChem CID 20570436) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-8-(5-methylhex-2-ynoxy)-1H-quinolin-2-one.
| Compound Name | 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-8-(5-methylhex-2-ynoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20570436 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-8-(5-methylhex-2-ynoxy)-1H-quinolin-2-one |
| SMILES | COc1ccc(CCNCC(O)COc2ccc(OCC#CCC(C)C)c3[nH]c(=O)ccc23)cc1OC |
| InChI | InChI=1S/C29H36N2O6/c1-20(2)7-5-6-16-36-26-12-11-24(23-9-13-28(33)31-29(23)26)37-19-22(32)18-30-15-14-21-8-10-25(34-3)27(17-21)35-4/h8-13,17,20,22,30,32H,7,14-16,18-19H2,1-4H3,(H,31,33) |
| InChIKey | QXFRGGSXUZLIDQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|