C29H36N2O7 — CID 20570332
5-[3-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-hydroxypropoxy]-8-(2-methyl-3-oxoheptan-4-yl)oxy-1H-quinolin-2-one (PubChem CID 20570332) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is 5-[3-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-hydroxypropoxy]-8-(2-methyl-3-oxoheptan-4-yl)oxy-1H-quinolin-2-one.
| Compound Name | 5-[3-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-hydroxypropoxy]-8-(2-methyl-3-oxoheptan-4-yl)oxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20570332 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 5-[3-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-hydroxypropoxy]-8-(2-methyl-3-oxoheptan-4-yl)oxy-1H-quinolin-2-one |
| SMILES | CCCC(Oc1ccc(OCC(O)CNCCc2ccc3c(c2)OCO3)c2ccc(=O)[nH]c12)C(=O)C(C)C |
| InChI | InChI=1S/C29H36N2O7/c1-4-5-25(29(34)18(2)3)38-24-10-9-22(21-7-11-27(33)31-28(21)24)35-16-20(32)15-30-13-12-19-6-8-23-26(14-19)37-17-36-23/h6-11,14,18,20,25,30,32H,4-5,12-13,15-17H2,1-3H3,(H,31,33) |
| InChIKey | IXEWEPKMIAZKIT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|