C11H13F2NO2 — CID 167488947
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2-difluoroethanamine (PubChem CID 167488947) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 167488947 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13F2NO2/c12-11(13)6-14-4-3-8-1-2-9-10(5-8)16-7-15-9/h1-2,5,11,14H,3-4,6-7H2 |
| InChIKey | SXVAVYPODRCSLD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|