C11H12F3NO2 — CID 167488970
N-[2-(1,3-benzodioxol-5-yl)ethyl]-1,1,2-trifluoroethanamine (PubChem CID 167488970) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-1,1,2-trifluoroethanamine.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-1,1,2-trifluoroethanamine |
|---|---|
| PubChem CID | 167488970 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-1,1,2-trifluoroethanamine |
| SMILES | FCC(F)(F)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12F3NO2/c12-6-11(13,14)15-4-3-8-1-2-9-10(5-8)17-7-16-9/h1-2,5,15H,3-4,6-7H2 |
| InChIKey | HXCFJBZXTBSYEX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|