C28H26N6O6 — CID 177395032
6-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 177395032) has the molecular formula C28H26N6O6 and a molecular weight of 542.55 g/mol. Its IUPAC name is 6-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 177395032 |
| Molecular Formula | C28H26N6O6 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 6-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1cc2c(cc1CCNc1nc(NCc3ccc4c(c3)OCO4)nc(NCc3ccc4c(c3)OCO4)n1)OCO2 |
| InChI | InChI=1S/C28H26N6O6/c1-4-20-23(38-14-35-20)9-17(1)7-8-29-26-32-27(30-12-18-2-5-21-24(10-18)39-15-36-21)34-28(33-26)31-13-19-3-6-22-25(11-19)40-16-37-22/h1-6,9-11H,7-8,12-16H2,(H3,29,30,31,32,33,34) |
| InChIKey | HYPYXONUQRTNIT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |