C22H26N6O2 — CID 117089564
4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 117089564) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 117089564 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-N-benzyl-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NCc2ccccc2)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C22H26N6O2/c1-3-28(4-2)22-26-20(23-13-16-8-6-5-7-9-16)25-21(27-22)24-14-17-10-11-18-19(12-17)30-15-29-18/h5-12H,3-4,13-15H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | WXSORLJENUGKLG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |