C22H30Cl2N10 — CID 11540669
6-chloro-4-N-[[3-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 11540669) has the molecular formula C22H30Cl2N10 and a molecular weight of 505.46 g/mol. Its IUPAC name is 6-chloro-4-N-[[3-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[[3-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11540669 |
| Molecular Formula | C22H30Cl2N10 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 6-chloro-4-N-[[3-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenyl]methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(NCc2cccc(CNc3nc(Cl)nc(N(CC)CC)n3)c2)n1 |
| InChI | InChI=1S/C22H30Cl2N10/c1-5-33(6-2)21-29-17(23)27-19(31-21)25-13-15-10-9-11-16(12-15)14-26-20-28-18(24)30-22(32-20)34(7-3)8-4/h9-12H,5-8,13-14H2,1-4H3,(H,25,27,29,31)(H,26,28,30,32) |
| InChIKey | QEZSAOBDOVQSRP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |