C14H18ClN5O — CID 106196572
2-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenol (PubChem CID 106196572) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 2-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenol.
| Compound Name | 2-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 106196572 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[[[4-chloro-6-(diethylamino)-1,3,5-triazin-2-yl]amino]methyl]phenol |
| SMILES | CCN(CC)c1nc(Cl)nc(NCc2ccccc2O)n1 |
| InChI | InChI=1S/C14H18ClN5O/c1-3-20(4-2)14-18-12(15)17-13(19-14)16-9-10-7-5-6-8-11(10)21/h5-8,21H,3-4,9H2,1-2H3,(H,16,17,18,19) |
| InChIKey | MXNHCKLOBQJLMW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|