C9H15Cl2N5 — CID 27378828
6-chloro-4-N-(2-chloroethyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 27378828) has the molecular formula C9H15Cl2N5 and a molecular weight of 264.16 g/mol. Its IUPAC name is 6-chloro-4-N-(2-chloroethyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(2-chloroethyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 27378828 |
| Molecular Formula | C9H15Cl2N5 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 6-chloro-4-N-(2-chloroethyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(NCCCl)n1 |
| InChI | InChI=1S/C9H15Cl2N5/c1-3-16(4-2)9-14-7(11)13-8(15-9)12-6-5-10/h3-6H2,1-2H3,(H,12,13,14,15) |
| InChIKey | SPMCIXHAAYXXLD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|