C10H18ClN5S — CID 63959456
6-chloro-2-N,2-N-diethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 63959456) has the molecular formula C10H18ClN5S and a molecular weight of 275.81 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-diethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-diethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 63959456 |
| Molecular Formula | C10H18ClN5S |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 6-chloro-2-N,2-N-diethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(NCCSC)n1 |
| InChI | InChI=1S/C10H18ClN5S/c1-4-16(5-2)10-14-8(11)13-9(15-10)12-6-7-17-3/h4-7H2,1-3H3,(H,12,13,14,15) |
| InChIKey | LCCDIWKRKFSLNK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|