C12H19ClN8 — CID 63330863
6-chloro-2-N,2-N-diethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 63330863) has the molecular formula C12H19ClN8 and a molecular weight of 310.79 g/mol. Its IUPAC name is 6-chloro-2-N,2-N-diethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,2-N-diethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 63330863 |
| Molecular Formula | C12H19ClN8 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-chloro-2-N,2-N-diethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(Cl)nc(NCCc2nncn2C)n1 |
| InChI | InChI=1S/C12H19ClN8/c1-4-21(5-2)12-17-10(13)16-11(18-12)14-7-6-9-19-15-8-20(9)3/h8H,4-7H2,1-3H3,(H,14,16,17,18) |
| InChIKey | MAXQVSUVMGSPPC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |