C11H19N9 — CID 80829386
2-N,2-N,6-N-trimethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80829386) has the molecular formula C11H19N9 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80829386 |
| Molecular Formula | C11H19N9 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCc2nncn2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H19N9/c1-12-9-15-10(17-11(16-9)19(2)3)13-6-5-8-18-14-7-20(8)4/h7H,5-6H2,1-4H3,(H2,12,13,15,16,17) |
| InChIKey | FPUWDOPXGYFGQM-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |