C10H21N7 — CID 80770283
4-N-[2-(dimethylamino)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80770283) has the molecular formula C10H21N7 and a molecular weight of 239.33 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80770283 |
| Molecular Formula | C10H21N7 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-N,2-N,6-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCN(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H21N7/c1-11-8-13-9(12-6-7-16(2)3)15-10(14-8)17(4)5/h6-7H2,1-5H3,(H2,11,12,13,14,15) |
| InChIKey | XWJVBPQWJKNSMM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |