C11H19F3N6 — CID 115523189
2-N,2-N,6-N-trimethyl-4-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 115523189) has the molecular formula C11H19F3N6 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 115523189 |
| Molecular Formula | C11H19F3N6 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCCCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H19F3N6/c1-15-8-17-9(19-10(18-8)20(2)3)16-7-5-4-6-11(12,13)14/h4-7H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | SIBOZRHBEOZMLS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|