C9H18N6S — CID 80839638
2-N,2-N,6-N-trimethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80839638) has the molecular formula C9H18N6S and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80839638 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(2-methylsulfanylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCSC)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H18N6S/c1-10-7-12-8(11-5-6-16-4)14-9(13-7)15(2)3/h5-6H2,1-4H3,(H2,10,11,12,13,14) |
| InChIKey | ZTXZMPHXVINJOM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|