C12H23N7O — CID 80777256
2-N,2-N,6-N-trimethyl-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80777256) has the molecular formula C12H23N7O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-N,2-N,6-N-trimethyl-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,6-N-trimethyl-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80777256 |
| Molecular Formula | C12H23N7O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-N,2-N,6-N-trimethyl-4-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCCN2CCOCC2)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H23N7O/c1-13-10-15-11(17-12(16-10)18(2)3)14-4-5-19-6-8-20-9-7-19/h4-9H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | NODTZUMJXJSBDW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |