C17H33N7 — CID 167281303
4-N-hexyl-6-N-methyl-2-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 167281303) has the molecular formula C17H33N7 and a molecular weight of 335.50 g/mol. Its IUPAC name is 4-N-hexyl-6-N-methyl-2-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-hexyl-6-N-methyl-2-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 167281303 |
| Molecular Formula | C17H33N7 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 4-N-hexyl-6-N-methyl-2-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCNc1nc(NC)nc(NCCN2CCCCC2)n1 |
| InChI | InChI=1S/C17H33N7/c1-3-4-5-7-10-19-16-21-15(18-2)22-17(23-16)20-11-14-24-12-8-6-9-13-24/h3-14H2,1-2H3,(H3,18,19,20,21,22,23) |
| InChIKey | NUWMHCZEWGQAJW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|