C14H30N8O — CID 91085436
azane;6-N-methyl-2-N-(3-morpholin-4-ylpropyl)-4-N-propyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 91085436) has the molecular formula C14H30N8O and a molecular weight of 326.45 g/mol. Its IUPAC name is azane;6-N-methyl-2-N-(3-morpholin-4-ylpropyl)-4-N-propyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | azane;6-N-methyl-2-N-(3-morpholin-4-ylpropyl)-4-N-propyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 91085436 |
| Molecular Formula | C14H30N8O |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | azane;6-N-methyl-2-N-(3-morpholin-4-ylpropyl)-4-N-propyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(NC)nc(NCCCN2CCOCC2)n1.N |
| InChI | InChI=1S/C14H27N7O.H3N/c1-3-5-16-13-18-12(15-2)19-14(20-13)17-6-4-7-21-8-10-22-11-9-21;/h3-11H2,1-2H3,(H3,15,16,17,18,19,20);1H3 |
| InChIKey | DDLCEVYKDPPWLQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|