C19H28N6O — CID 176671374
13-N,7-dimethyl-11-N-(3-morpholin-4-ylpropyl)-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaene-11,13-diamine (PubChem CID 176671374) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 13-N,7-dimethyl-11-N-(3-morpholin-4-ylpropyl)-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaene-11,13-diamine.
| Compound Name | 13-N,7-dimethyl-11-N-(3-morpholin-4-ylpropyl)-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaene-11,13-diamine |
|---|---|
| PubChem CID | 176671374 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 13-N,7-dimethyl-11-N-(3-morpholin-4-ylpropyl)-8,10,12-triazatricyclo[7.4.0.02,6]trideca-1,6,8,10,12-pentaene-11,13-diamine |
| SMILES | CNc1nc(NCCCN2CCOCC2)nc2nc(C)c3c(c12)CCC3 |
| InChI | InChI=1S/C19H28N6O/c1-13-14-5-3-6-15(14)16-17(20-2)23-19(24-18(16)22-13)21-7-4-8-25-9-11-26-12-10-25/h3-12H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | SRDKZKZHHRCBHF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|