C17H33N5O5 — CID 142192256
4,6-dimethoxy-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidin-2-amine;ethane (PubChem CID 142192256) has the molecular formula C17H33N5O5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidin-2-amine;ethane.
| Compound Name | 4,6-dimethoxy-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 142192256 |
| Molecular Formula | C17H33N5O5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 4,6-dimethoxy-N-(3-morpholin-4-ylpropyl)-5-nitropyrimidin-2-amine;ethane |
| SMILES | CC.CC.COc1nc(NCCCN2CCOCC2)nc(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O5.2C2H6/c1-21-11-10(18(19)20)12(22-2)16-13(15-11)14-4-3-5-17-6-8-23-9-7-17;2*1-2/h3-9H2,1-2H3,(H,14,15,16);2*1-2H3 |
| InChIKey | ICEACEOUFGZPGU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|