C19H23N5O6 — CID 23483309
methyl 4-[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 23483309) has the molecular formula C19H23N5O6 and a molecular weight of 417.42 g/mol. Its IUPAC name is methyl 4-[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 23483309 |
| Molecular Formula | C19H23N5O6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | methyl 4-[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(NCCCN3CCOCC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23N5O6/c1-28-19(25)14-3-5-15(6-4-14)30-18-16(24(26)27)17(21-13-22-18)20-7-2-8-23-9-11-29-12-10-23/h3-6,13H,2,7-12H2,1H3,(H,20,21,22) |
| InChIKey | TXHQRSADVRHZTH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|