C14H22N6O3 — CID 23487909
6-N-(3-morpholin-4-ylpropyl)-5-nitro-4-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 23487909) has the molecular formula C14H22N6O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is 6-N-(3-morpholin-4-ylpropyl)-5-nitro-4-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-morpholin-4-ylpropyl)-5-nitro-4-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23487909 |
| Molecular Formula | C14H22N6O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 6-N-(3-morpholin-4-ylpropyl)-5-nitro-4-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1ncnc(NCCCN2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N6O3/c1-2-4-15-13-12(20(21)22)14(18-11-17-13)16-5-3-6-19-7-9-23-10-8-19/h2,11H,1,3-10H2,(H2,15,16,17,18) |
| InChIKey | QRAVYLSIFRKHGB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|