C21H31N7O5S — CID 22526179
N,N-diethyl-4-[[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 22526179) has the molecular formula C21H31N7O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 22526179 |
| Molecular Formula | C21H31N7O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N,N-diethyl-4-[[6-(3-morpholin-4-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(NCCCN3CCOCC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H31N7O5S/c1-3-27(4-2)34(31,32)18-8-6-17(7-9-18)25-21-19(28(29)30)20(23-16-24-21)22-10-5-11-26-12-14-33-15-13-26/h6-9,16H,3-5,10-15H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | HOBHUGXOTPKLIJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|