C17H24N6O4S — CID 23487521
N,N-diethyl-4-[[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 23487521) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N,N-diethyl-4-[[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 23487521 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N,N-diethyl-4-[[5-nitro-6-(propan-2-ylamino)pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(NC(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H24N6O4S/c1-5-22(6-2)28(26,27)14-9-7-13(8-10-14)21-17-15(23(24)25)16(18-11-19-17)20-12(3)4/h7-12H,5-6H2,1-4H3,(H2,18,19,20,21) |
| InChIKey | FGJPEVSSAUMEJI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|