C20H20Cl2N6O4S — CID 22527799
4-[[6-(2,3-dichloroanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide (PubChem CID 22527799) has the molecular formula C20H20Cl2N6O4S and a molecular weight of 511.39 g/mol. Its IUPAC name is 4-[[6-(2,3-dichloroanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[6-(2,3-dichloroanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22527799 |
| Molecular Formula | C20H20Cl2N6O4S |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 4-[[6-(2,3-dichloroanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(Nc3cccc(Cl)c3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20Cl2N6O4S/c1-3-27(4-2)33(31,32)14-10-8-13(9-11-14)25-19-18(28(29)30)20(24-12-23-19)26-16-7-5-6-15(21)17(16)22/h5-12H,3-4H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | SAJMBPBOXYMBHM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|