C14H16Cl2N6O2 — CID 22530966
6-(2-tert-butylhydrazinyl)-N-(2,3-dichlorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 22530966) has the molecular formula C14H16Cl2N6O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-N-(2,3-dichlorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-N-(2,3-dichlorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22530966 |
| Molecular Formula | C14H16Cl2N6O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-N-(2,3-dichlorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)NNc1ncnc(Nc2cccc(Cl)c2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16Cl2N6O2/c1-14(2,3)21-20-13-11(22(23)24)12(17-7-18-13)19-9-6-4-5-8(15)10(9)16/h4-7,21H,1-3H3,(H2,17,18,19,20) |
| InChIKey | WEHIUBQEVLZDJI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|