C16H22N6O2 — CID 23482737
6-(2-tert-butylhydrazinyl)-N-(2-ethylphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23482737) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-N-(2-ethylphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-N-(2-ethylphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23482737 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-N-(2-ethylphenyl)-5-nitropyrimidin-4-amine |
| SMILES | CCc1ccccc1Nc1ncnc(NNC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N6O2/c1-5-11-8-6-7-9-12(11)19-14-13(22(23)24)15(18-10-17-14)20-21-16(2,3)4/h6-10,21H,5H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | FHKZTENNZIHHCB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|