C16H10Cl2N4O3 — CID 22530963
N-(2,3-dichlorophenyl)-5-nitro-6-phenoxypyrimidin-4-amine (PubChem CID 22530963) has the molecular formula C16H10Cl2N4O3 and a molecular weight of 377.19 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-5-nitro-6-phenoxypyrimidin-4-amine.
| Compound Name | N-(2,3-dichlorophenyl)-5-nitro-6-phenoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 22530963 |
| Molecular Formula | C16H10Cl2N4O3 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-5-nitro-6-phenoxypyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2Cl)ncnc1Oc1ccccc1 |
| InChI | InChI=1S/C16H10Cl2N4O3/c17-11-7-4-8-12(13(11)18)21-15-14(22(23)24)16(20-9-19-15)25-10-5-2-1-3-6-10/h1-9H,(H,19,20,21) |
| InChIKey | ZCYLEKIGZLGHQQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|