C17H19Cl2N5O2 — CID 22530998
4-N-cycloheptyl-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22530998) has the molecular formula C17H19Cl2N5O2 and a molecular weight of 396.28 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-cycloheptyl-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22530998 |
| Molecular Formula | C17H19Cl2N5O2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-N-cycloheptyl-6-N-(2,3-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2Cl)ncnc1NC1CCCCCC1 |
| InChI | InChI=1S/C17H19Cl2N5O2/c18-12-8-5-9-13(14(12)19)23-17-15(24(25)26)16(20-10-21-17)22-11-6-3-1-2-4-7-11/h5,8-11H,1-4,6-7H2,(H2,20,21,22,23) |
| InChIKey | BNIHJUGKIFXTED-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|