C16H17Cl2N5O2 — CID 23491920
N-(2,3-dichlorophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23491920) has the molecular formula C16H17Cl2N5O2 and a molecular weight of 382.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,3-dichlorophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491920 |
| Molecular Formula | C16H17Cl2N5O2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1CCCN(c2ncnc(Nc3cccc(Cl)c3Cl)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H17Cl2N5O2/c1-10-4-3-7-22(8-10)16-14(23(24)25)15(19-9-20-16)21-12-6-2-5-11(17)13(12)18/h2,5-6,9-10H,3-4,7-8H2,1H3,(H,19,20,21) |
| InChIKey | ZWEZTASZUJBSPJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|