C16H18BrN5O2 — CID 23491938
N-(4-bromophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23491938) has the molecular formula C16H18BrN5O2 and a molecular weight of 392.26 g/mol. Its IUPAC name is N-(4-bromophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(4-bromophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491938 |
| Molecular Formula | C16H18BrN5O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-(4-bromophenyl)-6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CC1CCCN(c2ncnc(Nc3ccc(Br)cc3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H18BrN5O2/c1-11-3-2-8-21(9-11)16-14(22(23)24)15(18-10-19-16)20-13-6-4-12(17)5-7-13/h4-7,10-11H,2-3,8-9H2,1H3,(H,18,19,20) |
| InChIKey | LHYPEWBOEMEBIQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|