C17H19N7O5 — CID 23491965
N'-[6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide (PubChem CID 23491965) has the molecular formula C17H19N7O5 and a molecular weight of 401.38 g/mol. Its IUPAC name is N'-[6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide.
| Compound Name | N'-[6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23491965 |
| Molecular Formula | C17H19N7O5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N'-[6-(3-methylpiperidin-1-yl)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
| SMILES | CC1CCCN(c2ncnc(NNC(=O)c3ccc([N+](=O)[O-])cc3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H19N7O5/c1-11-3-2-8-22(9-11)16-14(24(28)29)15(18-10-19-16)20-21-17(25)12-4-6-13(7-5-12)23(26)27/h4-7,10-11H,2-3,8-9H2,1H3,(H,21,25)(H,18,19,20) |
| InChIKey | DPRNWMSLYDLASB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|