C19H21N7O7 — CID 23494349
ethyl 1-[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494349) has the molecular formula C19H21N7O7 and a molecular weight of 459.42 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494349 |
| Molecular Formula | C19H21N7O7 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | ethyl 1-[5-nitro-6-[2-(3-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NNC(=O)c3cccc([N+](=O)[O-])c3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H21N7O7/c1-2-33-19(28)13-6-4-8-24(10-13)17-15(26(31)32)16(20-11-21-17)22-23-18(27)12-5-3-7-14(9-12)25(29)30/h3,5,7,9,11,13H,2,4,6,8,10H2,1H3,(H,23,27)(H,20,21,22) |
| InChIKey | FWTOMOPIHYOLFH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|