C15H23N5O4 — CID 23487299
ethyl 1-[5-nitro-6-(propylamino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23487299) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-(propylamino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-(propylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23487299 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | ethyl 1-[5-nitro-6-(propylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCCNc1ncnc(N2CCCC(C(=O)OCC)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N5O4/c1-3-7-16-13-12(20(22)23)14(18-10-17-13)19-8-5-6-11(9-19)15(21)24-4-2/h10-11H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | LRRNEWKMRDXVBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|