C13H21N5O3 — CID 102971520
6-(3-methoxypiperidin-1-yl)-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 102971520) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-(3-methoxypiperidin-1-yl)-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-(3-methoxypiperidin-1-yl)-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102971520 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-(3-methoxypiperidin-1-yl)-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(N2CCCC(OC)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O3/c1-3-6-14-12-11(18(19)20)13(16-9-15-12)17-7-4-5-10(8-17)21-2/h9-10H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | GEOKXDJEZZWEFF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|