C19H21N5O6 — CID 23480585
ethyl 1-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23480585) has the molecular formula C19H21N5O6 and a molecular weight of 415.41 g/mol. Its IUPAC name is ethyl 1-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23480585 |
| Molecular Formula | C19H21N5O6 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | ethyl 1-[6-(1,3-benzodioxol-5-ylamino)-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3ccc4c(c3)OCO4)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H21N5O6/c1-2-28-19(25)12-4-3-7-23(9-12)18-16(24(26)27)17(20-10-21-18)22-13-5-6-14-15(8-13)30-11-29-14/h5-6,8,10,12H,2-4,7,9,11H2,1H3,(H,20,21,22) |
| InChIKey | PSRLWFRHKWSROQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|