C19H19ClF3N5O4 — CID 23479646
ethyl 1-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23479646) has the molecular formula C19H19ClF3N5O4 and a molecular weight of 473.84 g/mol. Its IUPAC name is ethyl 1-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23479646 |
| Molecular Formula | C19H19ClF3N5O4 |
| Molecular Weight | 473.84 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | ethyl 1-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3cc(C(F)(F)F)ccc3Cl)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H19ClF3N5O4/c1-2-32-18(29)11-4-3-7-27(9-11)17-15(28(30)31)16(24-10-25-17)26-14-8-12(19(21,22)23)5-6-13(14)20/h5-6,8,10-11H,2-4,7,9H2,1H3,(H,24,25,26) |
| InChIKey | KGQRBMKCHQRMDJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|