C17H20N8O5 — CID 23490349
N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 23490349) has the molecular formula C17H20N8O5 and a molecular weight of 416.40 g/mol. Its IUPAC name is N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23490349 |
| Molecular Formula | C17H20N8O5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | CCN1CCN(c2ncnc(NNC(=O)c3cccc([N+](=O)[O-])c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H20N8O5/c1-2-22-6-8-23(9-7-22)16-14(25(29)30)15(18-11-19-16)20-21-17(26)12-4-3-5-13(10-12)24(27)28/h3-5,10-11H,2,6-9H2,1H3,(H,21,26)(H,18,19,20) |
| InChIKey | UWFNUKIIYOZEIJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|