C16H17N7O5 — CID 22536055
N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536055) has the molecular formula C16H17N7O5 and a molecular weight of 387.36 g/mol. Its IUPAC name is N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536055 |
| Molecular Formula | C16H17N7O5 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NC2CCCC2)c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17N7O5/c24-16(10-4-3-7-12(8-10)22(25)26)21-20-15-13(23(27)28)14(17-9-18-15)19-11-5-1-2-6-11/h3-4,7-9,11H,1-2,5-6H2,(H,21,24)(H2,17,18,19,20) |
| InChIKey | FPLSLBIDOADRNH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|