C16H16Cl2N6O3 — CID 22536438
2,4-dichloro-N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22536438) has the molecular formula C16H16Cl2N6O3 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2,4-dichloro-N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22536438 |
| Molecular Formula | C16H16Cl2N6O3 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2,4-dichloro-N'-[6-(cyclopentylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(NC2CCCC2)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N6O3/c17-9-5-6-11(12(18)7-9)16(25)23-22-15-13(24(26)27)14(19-8-20-15)21-10-3-1-2-4-10/h5-8,10H,1-4H2,(H,23,25)(H2,19,20,21,22) |
| InChIKey | GZJQZSBLBJLZHN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|