C16H18Cl2N8O3 — CID 22526397
2,4-dichloro-N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22526397) has the molecular formula C16H18Cl2N8O3 and a molecular weight of 441.28 g/mol. Its IUPAC name is 2,4-dichloro-N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22526397 |
| Molecular Formula | C16H18Cl2N8O3 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2,4-dichloro-N'-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | CN1CCN(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3Cl)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H18Cl2N8O3/c1-24-4-6-25(7-5-24)23-15-13(26(28)29)14(19-9-20-15)21-22-16(27)11-3-2-10(17)8-12(11)18/h2-3,8-9H,4-7H2,1H3,(H,22,27)(H2,19,20,21,23) |
| InChIKey | ARWUYYWZNMDZGI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|