C14H9Cl2N7O3 — CID 22536464
2,4-dichloro-N'-(6-imidazol-1-yl-5-nitropyrimidin-4-yl)benzohydrazide (PubChem CID 22536464) has the molecular formula C14H9Cl2N7O3 and a molecular weight of 394.18 g/mol. Its IUPAC name is 2,4-dichloro-N'-(6-imidazol-1-yl-5-nitropyrimidin-4-yl)benzohydrazide.
| Compound Name | 2,4-dichloro-N'-(6-imidazol-1-yl-5-nitropyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 22536464 |
| Molecular Formula | C14H9Cl2N7O3 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2,4-dichloro-N'-(6-imidazol-1-yl-5-nitropyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(-n2ccnc2)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N7O3/c15-8-1-2-9(10(16)5-8)14(24)21-20-12-11(23(25)26)13(19-6-18-12)22-4-3-17-7-22/h1-7H,(H,21,24)(H,18,19,20) |
| InChIKey | VODBRNNATCLTDI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|