C12H8ClN7O2 — CID 22531273
N-(5-chloro-2-pyridinyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine (PubChem CID 22531273) has the molecular formula C12H8ClN7O2 and a molecular weight of 317.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine.
| Compound Name | N-(5-chloro-2-pyridinyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22531273 |
| Molecular Formula | C12H8ClN7O2 |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Cl)cn2)ncnc1-n1ccnc1 |
| InChI | InChI=1S/C12H8ClN7O2/c13-8-1-2-9(15-5-8)18-11-10(20(21)22)12(17-6-16-11)19-4-3-14-7-19/h1-7H,(H,15,16,17,18) |
| InChIKey | KQMLJLMXVWXHFB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|