C18H11Cl2F3N6O4 — CID 22536432
2,4-dichloro-N'-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzohydrazide (PubChem CID 22536432) has the molecular formula C18H11Cl2F3N6O4 and a molecular weight of 503.22 g/mol. Its IUPAC name is 2,4-dichloro-N'-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22536432 |
| Molecular Formula | C18H11Cl2F3N6O4 |
| Molecular Weight | 503.22 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2,4-dichloro-N'-[5-nitro-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(OC(F)(F)F)cc2)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl2F3N6O4/c19-9-1-6-12(13(20)7-9)17(30)28-27-16-14(29(31)32)15(24-8-25-16)26-10-2-4-11(5-3-10)33-18(21,22)23/h1-8H,(H,28,30)(H2,24,25,26,27) |
| InChIKey | MJWYEUJXPSPYEW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|