C17H13F3N6O3 — CID 22526735
5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 22526735) has the molecular formula C17H13F3N6O3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22526735 |
| Molecular Formula | C17H13F3N6O3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 5-nitro-6-(2-phenylhydrazinyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NNc2ccccc2)ncnc1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N6O3/c18-17(19,20)29-13-8-6-11(7-9-13)23-15-14(26(27)28)16(22-10-21-15)25-24-12-4-2-1-3-5-12/h1-10,24H,(H2,21,22,23,25) |
| InChIKey | ISMPWPOGBQXTFK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|