C28H21N5O4 — CID 22538995
5-nitro-4-N,6-N-bis(4-phenoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 22538995) has the molecular formula C28H21N5O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is 5-nitro-4-N,6-N-bis(4-phenoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N,6-N-bis(4-phenoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538995 |
| Molecular Formula | C28H21N5O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 5-nitro-4-N,6-N-bis(4-phenoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Oc3ccccc3)cc2)ncnc1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N5O4/c34-33(35)26-27(31-20-11-15-24(16-12-20)36-22-7-3-1-4-8-22)29-19-30-28(26)32-21-13-17-25(18-14-21)37-23-9-5-2-6-10-23/h1-19H,(H2,29,30,31,32) |
| InChIKey | FHFBJDPVEKRFIB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|