C23H17ClN6O4 — CID 22535410
4-chloro-N'-[5-nitro-6-(4-phenoxyanilino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22535410) has the molecular formula C23H17ClN6O4 and a molecular weight of 476.88 g/mol. Its IUPAC name is 4-chloro-N'-[5-nitro-6-(4-phenoxyanilino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-N'-[5-nitro-6-(4-phenoxyanilino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535410 |
| Molecular Formula | C23H17ClN6O4 |
| Molecular Weight | 476.88 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-chloro-N'-[5-nitro-6-(4-phenoxyanilino)pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(Oc3ccccc3)cc2)c1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN6O4/c24-16-8-6-15(7-9-16)23(31)29-28-22-20(30(32)33)21(25-14-26-22)27-17-10-12-19(13-11-17)34-18-4-2-1-3-5-18/h1-14H,(H,29,31)(H2,25,26,27,28) |
| InChIKey | JCHRTLTWEQCTNA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|