C17H12ClFN6O3 — CID 22527698
4-chloro-N'-[6-(2-fluoroanilino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22527698) has the molecular formula C17H12ClFN6O3 and a molecular weight of 402.77 g/mol. Its IUPAC name is 4-chloro-N'-[6-(2-fluoroanilino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-N'-[6-(2-fluoroanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22527698 |
| Molecular Formula | C17H12ClFN6O3 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-chloro-N'-[6-(2-fluoroanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccccc2F)c1[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClFN6O3/c18-11-7-5-10(6-8-11)17(26)24-23-16-14(25(27)28)15(20-9-21-16)22-13-4-2-1-3-12(13)19/h1-9H,(H,24,26)(H2,20,21,22,23) |
| InChIKey | LVIJMCYUOVHRRX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|