C19H16N6O4 — CID 22533609
N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22533609) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22533609 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | CC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N6O4/c1-12(26)13-7-9-15(10-8-13)22-17-16(25(28)29)18(21-11-20-17)23-24-19(27)14-5-3-2-4-6-14/h2-11H,1H3,(H,24,27)(H2,20,21,22,23) |
| InChIKey | GFBXLYFJKUDKCB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|