C18H15N7O4 — CID 22533628
N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 22533628) has the molecular formula C18H15N7O4 and a molecular weight of 393.36 g/mol. Its IUPAC name is N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 22533628 |
| Molecular Formula | C18H15N7O4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N'-[6-(4-acetylanilino)-5-nitropyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | CC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccncc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N7O4/c1-11(26)12-2-4-14(5-3-12)22-16-15(25(28)29)17(21-10-20-16)23-24-18(27)13-6-8-19-9-7-13/h2-10H,1H3,(H,24,27)(H2,20,21,22,23) |
| InChIKey | OVYPYEUVDFGSGT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 152.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|